About (4Z)-2-methyl-4-(3,3,3-trifluoropropylsulfanylmethylidene)heptane
(4Z)-2-methyl-4-(3,3,3-trifluoropropylsulfanylmethylidene)heptane (PubChem CID 162576874) has the molecular formula C12H21F3S
and a molecular weight of 254.36 g/mol. Its IUPAC name is (4Z)-2-methyl-4-(3,3,3-trifluoropropylsulfanylmethylidene)heptane.
Molecular Properties
| Compound Name | (4Z)-2-methyl-4-(3,3,3-trifluoropropylsulfanylmethylidene)heptane |
| PubChem CID | 162576874 |
| Molecular Formula | C12H21F3S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (4Z)-2-methyl-4-(3,3,3-trifluoropropylsulfanylmethylidene)heptane |
| SMILES | CCC/C(=C/SCCC(F)(F)F)CC(C)C |
| InChI | InChI=1S/C12H21F3S/c1-4-5-11(8-10(2)3)9-16-7-6-12(13,14)15/h9-10H,4-8H2,1-3H3/b11-9- |
| InChIKey | FUIFWUZZAMGCFZ-LUAWRHEFSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-2-methyl-4-(3,3,3-trifluoropropylsulfanylmethylidene)heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-2-methyl-4-(3,3,3-trifluoropropylsulfanylmethylidene)heptane?
The IUPAC name of (4Z)-2-methyl-4-(3,3,3-trifluoropropylsulfanylmethylidene)heptane (CID 162576874) is (4Z)-2-methyl-4-(3,3,3-trifluoropropylsulfanylmethylidene)heptane.
What is the SMILES notation for (4Z)-2-methyl-4-(3,3,3-trifluoropropylsulfanylmethylidene)heptane?
The canonical SMILES for (4Z)-2-methyl-4-(3,3,3-trifluoropropylsulfanylmethylidene)heptane is CCC/C(=C/SCCC(F)(F)F)CC(C)C.
What is the InChIKey of (4Z)-2-methyl-4-(3,3,3-trifluoropropylsulfanylmethylidene)heptane?
The InChIKey is FUIFWUZZAMGCFZ-LUAWRHEFSA-N. The full InChI is InChI=1S/C12H21F3S/c1-4-5-11(8-10(2)3)9-16-7-6-12(13,14)15/h9-10H,4-8H2,1-3H3/b11-9-.
What are the key properties of (4Z)-2-methyl-4-(3,3,3-trifluoropropylsulfanylmethylidene)heptane?
(4Z)-2-methyl-4-(3,3,3-trifluoropropylsulfanylmethylidene)heptane has a molecular weight of 254.36 g/mol, XLogP of 5.40, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-2-methyl-4-(3,3,3-trifluoropropylsulfanylmethylidene)heptane is sourced from PubChem (CID 162576874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).