About [5-methyl-2,2-bis(trifluoromethyl)-1,3-dioxan-4-yl]methylalumane
[5-methyl-2,2-bis(trifluoromethyl)-1,3-dioxan-4-yl]methylalumane (PubChem CID 162576993) has the molecular formula C8H11AlF6O2
and a molecular weight of 280.14 g/mol. Its IUPAC name is [5-methyl-2,2-bis(trifluoromethyl)-1,3-dioxan-4-yl]methylalumane.
Molecular Properties
| Compound Name | [5-methyl-2,2-bis(trifluoromethyl)-1,3-dioxan-4-yl]methylalumane |
| PubChem CID | 162576993 |
| Molecular Formula | C8H11AlF6O2 |
| Molecular Weight | 280.14 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | [5-methyl-2,2-bis(trifluoromethyl)-1,3-dioxan-4-yl]methylalumane |
| SMILES | CC1COC(C(F)(F)F)(C(F)(F)F)OC1C[AlH2] |
| InChI | InChI=1S/C8H9F6O2.Al.2H/c1-4-3-15-6(7(9,10)11,8(12,13)14)16-5(4)2;;;/h4-5H,2-3H2,1H3;;; |
| InChIKey | YNNFADGYWSNVGZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.14 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [5-methyl-2,2-bis(trifluoromethyl)-1,3-dioxan-4-yl]methylalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-methyl-2,2-bis(trifluoromethyl)-1,3-dioxan-4-yl]methylalumane?
The IUPAC name of [5-methyl-2,2-bis(trifluoromethyl)-1,3-dioxan-4-yl]methylalumane (CID 162576993) is [5-methyl-2,2-bis(trifluoromethyl)-1,3-dioxan-4-yl]methylalumane.
What is the SMILES notation for [5-methyl-2,2-bis(trifluoromethyl)-1,3-dioxan-4-yl]methylalumane?
The canonical SMILES for [5-methyl-2,2-bis(trifluoromethyl)-1,3-dioxan-4-yl]methylalumane is CC1COC(C(F)(F)F)(C(F)(F)F)OC1C[AlH2].
What is the InChIKey of [5-methyl-2,2-bis(trifluoromethyl)-1,3-dioxan-4-yl]methylalumane?
The InChIKey is YNNFADGYWSNVGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F6O2.Al.2H/c1-4-3-15-6(7(9,10)11,8(12,13)14)16-5(4)2;;;/h4-5H,2-3H2,1H3;;;.
What are the key properties of [5-methyl-2,2-bis(trifluoromethyl)-1,3-dioxan-4-yl]methylalumane?
[5-methyl-2,2-bis(trifluoromethyl)-1,3-dioxan-4-yl]methylalumane has a molecular weight of 280.14 g/mol, XLogP of 1.91, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-methyl-2,2-bis(trifluoromethyl)-1,3-dioxan-4-yl]methylalumane is sourced from PubChem (CID 162576993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).