C30H34F3NO4S — CID 162577244
(E,2R)-6-[1-[[(2S)-3-methyl-2-sulfanylbutanoyl]amino]cyclopentyl]-6-oxo-2-[[4-[3-(trifluoromethyl)phenyl]phenyl]methyl]hex-3-enoic acid (PubChem CID 162577244) has the molecular formula C30H34F3NO4S and a molecular weight of 561.67 g/mol. Its IUPAC name is (E,2R)-6-[1-[[(2S)-3-methyl-2-sulfanylbutanoyl]amino]cyclopentyl]-6-oxo-2-[[4-[3-(trifluoromethyl)phenyl]phenyl]methyl]hex-3-enoic acid.
| Compound Name | (E,2R)-6-[1-[[(2S)-3-methyl-2-sulfanylbutanoyl]amino]cyclopentyl]-6-oxo-2-[[4-[3-(trifluoromethyl)phenyl]phenyl]methyl]hex-3-enoic acid |
|---|---|
| PubChem CID | 162577244 |
| Molecular Formula | C30H34F3NO4S |
| Molecular Weight | 561.67 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | (E,2R)-6-[1-[[(2S)-3-methyl-2-sulfanylbutanoyl]amino]cyclopentyl]-6-oxo-2-[[4-[3-(trifluoromethyl)phenyl]phenyl]methyl]hex-3-enoic acid |
| SMILES | CC(C)[C@H](S)C(=O)NC1(C(=O)C/C=C/[C@@H](Cc2ccc(-c3cccc(C(F)(F)F)c3)cc2)C(=O)O)CCCC1 |
| InChI | InChI=1S/C30H34F3NO4S/c1-19(2)26(39)27(36)34-29(15-3-4-16-29)25(35)10-6-8-23(28(37)38)17-20-11-13-21(14-12-20)22-7-5-9-24(18-22)30(31,32)33/h5-9,11-14,18-19,23,26,39H,3-4,10,15-17H2,1-2H3,(H,34,36)(H,37,38)/b8-6+/t23-,26-/m0/s1 |
| InChIKey | KJGSBYUFZRVROM-RRTBHDGLSA-N |
| XLogP | 6.51 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.67 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|