C19H29F3N2O5S — CID 162577567
methyl 4-[4-[(2E,4E)-6,6,6-trifluoro-5-methylhexa-2,4-dien-2-yl]oxypiperidin-1-yl]sulfonylpiperidine-4-carboxylate (PubChem CID 162577567) has the molecular formula C19H29F3N2O5S and a molecular weight of 454.51 g/mol. Its IUPAC name is methyl 4-[4-[(2E,4E)-6,6,6-trifluoro-5-methylhexa-2,4-dien-2-yl]oxypiperidin-1-yl]sulfonylpiperidine-4-carboxylate.
| Compound Name | methyl 4-[4-[(2E,4E)-6,6,6-trifluoro-5-methylhexa-2,4-dien-2-yl]oxypiperidin-1-yl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 162577567 |
| Molecular Formula | C19H29F3N2O5S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | methyl 4-[4-[(2E,4E)-6,6,6-trifluoro-5-methylhexa-2,4-dien-2-yl]oxypiperidin-1-yl]sulfonylpiperidine-4-carboxylate |
| SMILES | COC(=O)C1(S(=O)(=O)N2CCC(O/C(C)=C/C=C(\C)C(F)(F)F)CC2)CCNCC1 |
| InChI | InChI=1S/C19H29F3N2O5S/c1-14(19(20,21)22)4-5-15(2)29-16-6-12-24(13-7-16)30(26,27)18(17(25)28-3)8-10-23-11-9-18/h4-5,16,23H,6-13H2,1-3H3/b14-4+,15-5+ |
| InChIKey | PHPAABVXWGSESF-VHUAAIQRSA-N |
| XLogP | 2.50 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|