C21H17F3N4O3 — CID 162577587
4-N-[N'-(2-methyl-1-benzofuran-5-yl)-N-methylidenecarbamimidoyl]-1-N-(2,2,2-trifluoroethyl)benzene-1,4-dicarboxamide (PubChem CID 162577587) has the molecular formula C21H17F3N4O3 and a molecular weight of 430.39 g/mol. Its IUPAC name is 4-N-[N'-(2-methyl-1-benzofuran-5-yl)-N-methylidenecarbamimidoyl]-1-N-(2,2,2-trifluoroethyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-[N'-(2-methyl-1-benzofuran-5-yl)-N-methylidenecarbamimidoyl]-1-N-(2,2,2-trifluoroethyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 162577587 |
| Molecular Formula | C21H17F3N4O3 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 4-N-[N'-(2-methyl-1-benzofuran-5-yl)-N-methylidenecarbamimidoyl]-1-N-(2,2,2-trifluoroethyl)benzene-1,4-dicarboxamide |
| SMILES | C=N/C(=N\c1ccc2oc(C)cc2c1)NC(=O)c1ccc(C(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H17F3N4O3/c1-12-9-15-10-16(7-8-17(15)31-12)27-20(25-2)28-19(30)14-5-3-13(4-6-14)18(29)26-11-21(22,23)24/h3-10H,2,11H2,1H3,(H,26,29)(H,27,28,30) |
| InChIKey | ORRODQRFGFIOPK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|