C16H23F4NO2 — CID 162577750
4-[[4-(2,2,3,3-tetrafluoropropoxymethyl)cyclohexa-1,5-dien-1-yl]methoxy]piperidine (PubChem CID 162577750) has the molecular formula C16H23F4NO2 and a molecular weight of 337.36 g/mol. Its IUPAC name is 4-[[4-(2,2,3,3-tetrafluoropropoxymethyl)cyclohexa-1,5-dien-1-yl]methoxy]piperidine.
| Compound Name | 4-[[4-(2,2,3,3-tetrafluoropropoxymethyl)cyclohexa-1,5-dien-1-yl]methoxy]piperidine |
|---|---|
| PubChem CID | 162577750 |
| Molecular Formula | C16H23F4NO2 |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 4-[[4-(2,2,3,3-tetrafluoropropoxymethyl)cyclohexa-1,5-dien-1-yl]methoxy]piperidine |
| SMILES | FC(F)C(F)(F)COCC1C=CC(COC2CCNCC2)=CC1 |
| InChI | InChI=1S/C16H23F4NO2/c17-15(18)16(19,20)11-22-9-12-1-3-13(4-2-12)10-23-14-5-7-21-8-6-14/h1,3-4,12,14-15,21H,2,5-11H2 |
| InChIKey | JDCVEZKUKPPYSM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|