C20H19F3N2O3S — CID 162577797
N,N-dihydroxy-2-[4-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]phenyl]ethanamine (PubChem CID 162577797) has the molecular formula C20H19F3N2O3S and a molecular weight of 424.44 g/mol. Its IUPAC name is N,N-dihydroxy-2-[4-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]phenyl]ethanamine.
| Compound Name | N,N-dihydroxy-2-[4-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]phenyl]ethanamine |
|---|---|
| PubChem CID | 162577797 |
| Molecular Formula | C20H19F3N2O3S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | N,N-dihydroxy-2-[4-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]phenyl]ethanamine |
| SMILES | Cc1nc(-c2ccc(C(F)(F)F)cc2)sc1COc1ccc(CCN(O)O)cc1 |
| InChI | InChI=1S/C20H19F3N2O3S/c1-13-18(12-28-17-8-2-14(3-9-17)10-11-25(26)27)29-19(24-13)15-4-6-16(7-5-15)20(21,22)23/h2-9,26-27H,10-12H2,1H3 |
| InChIKey | IJDNYUAYBHDSOT-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|