C14H24F3NO2 — CID 162578434
6-(1-amino-2,2,2-trifluoroethyl)-2,4-dipropylcyclohex-4-ene-1,3-diol (PubChem CID 162578434) has the molecular formula C14H24F3NO2 and a molecular weight of 295.35 g/mol. Its IUPAC name is 6-(1-amino-2,2,2-trifluoroethyl)-2,4-dipropylcyclohex-4-ene-1,3-diol.
| Compound Name | 6-(1-amino-2,2,2-trifluoroethyl)-2,4-dipropylcyclohex-4-ene-1,3-diol |
|---|---|
| PubChem CID | 162578434 |
| Molecular Formula | C14H24F3NO2 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 6-(1-amino-2,2,2-trifluoroethyl)-2,4-dipropylcyclohex-4-ene-1,3-diol |
| SMILES | CCCC1=CC(C(N)C(F)(F)F)C(O)C(CCC)C1O |
| InChI | InChI=1S/C14H24F3NO2/c1-3-5-8-7-10(13(18)14(15,16)17)12(20)9(6-4-2)11(8)19/h7,9-13,19-20H,3-6,18H2,1-2H3 |
| InChIKey | LIJVDXADLJJHMN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|