C10H14F3NO — CID 162578637
(3E,5Z)-3-methyl-7-(trifluoromethoxy)octa-3,5,7-trien-2-amine (PubChem CID 162578637) has the molecular formula C10H14F3NO and a molecular weight of 221.22 g/mol. Its IUPAC name is (3E,5Z)-3-methyl-7-(trifluoromethoxy)octa-3,5,7-trien-2-amine.
| Compound Name | (3E,5Z)-3-methyl-7-(trifluoromethoxy)octa-3,5,7-trien-2-amine |
|---|---|
| PubChem CID | 162578637 |
| Molecular Formula | C10H14F3NO |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | (3E,5Z)-3-methyl-7-(trifluoromethoxy)octa-3,5,7-trien-2-amine |
| SMILES | C=C(/C=C\C=C(/C)C(C)N)OC(F)(F)F |
| InChI | InChI=1S/C10H14F3NO/c1-7(9(3)14)5-4-6-8(2)15-10(11,12)13/h4-6,9H,2,14H2,1,3H3/b6-4-,7-5+ |
| InChIKey | NSDVPJRGTBQAQD-XGXWUAJZSA-N |
| XLogP | 2.89 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|