C25H19F3N2O5S — CID 162579003
(5Z)-5-[[3-[3,3-dimethyl-5-(1,2-oxazol-5-yl)-2H-1-benzofuran-7-yl]-4-(2,2,2-trifluoroethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 162579003) has the molecular formula C25H19F3N2O5S and a molecular weight of 516.50 g/mol. Its IUPAC name is (5Z)-5-[[3-[3,3-dimethyl-5-(1,2-oxazol-5-yl)-2H-1-benzofuran-7-yl]-4-(2,2,2-trifluoroethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-[3,3-dimethyl-5-(1,2-oxazol-5-yl)-2H-1-benzofuran-7-yl]-4-(2,2,2-trifluoroethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 162579003 |
| Molecular Formula | C25H19F3N2O5S |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | (5Z)-5-[[3-[3,3-dimethyl-5-(1,2-oxazol-5-yl)-2H-1-benzofuran-7-yl]-4-(2,2,2-trifluoroethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC1(C)COc2c(-c3cc(/C=C4\SC(=O)NC4=O)ccc3OCC(F)(F)F)cc(-c3ccno3)cc21 |
| InChI | InChI=1S/C25H19F3N2O5S/c1-24(2)11-34-21-16(9-14(10-17(21)24)18-5-6-29-35-18)15-7-13(8-20-22(31)30-23(32)36-20)3-4-19(15)33-12-25(26,27)28/h3-10H,11-12H2,1-2H3,(H,30,31,32)/b20-8- |
| InChIKey | JCBZBTFNDBNSSH-ZBKNUEDVSA-N |
| XLogP | 5.94 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|