C17H24F5NO — CID 162579431
1-[2-[1,5-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)cyclohexa-2,4-dien-1-yl]oxyethyl]piperidine (PubChem CID 162579431) has the molecular formula C17H24F5NO and a molecular weight of 353.38 g/mol. Its IUPAC name is 1-[2-[1,5-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)cyclohexa-2,4-dien-1-yl]oxyethyl]piperidine.
| Compound Name | 1-[2-[1,5-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)cyclohexa-2,4-dien-1-yl]oxyethyl]piperidine |
|---|---|
| PubChem CID | 162579431 |
| Molecular Formula | C17H24F5NO |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 1-[2-[1,5-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)cyclohexa-2,4-dien-1-yl]oxyethyl]piperidine |
| SMILES | CC1=CC=C(C(F)(F)C(F)(F)F)C(C)(OCCN2CCCCC2)C1 |
| InChI | InChI=1S/C17H24F5NO/c1-13-6-7-14(16(18,19)17(20,21)22)15(2,12-13)24-11-10-23-8-4-3-5-9-23/h6-7H,3-5,8-12H2,1-2H3 |
| InChIKey | GSHHICBSVOMTNS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|