C23H29F3N2O2 — CID 162579733
4-[(11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]-2,2-dimethylbutanoic acid (PubChem CID 162579733) has the molecular formula C23H29F3N2O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is 4-[(11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[(11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 162579733 |
| Molecular Formula | C23H29F3N2O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 4-[(11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]-2,2-dimethylbutanoic acid |
| SMILES | C[C@H]1c2c([nH]c3ccc(C(F)(F)F)cc23)CC2CCN(CCC(C)(C)C(=O)O)C[C@@H]21 |
| InChI | InChI=1S/C23H29F3N2O2/c1-13-17-12-28(9-7-22(2,3)21(29)30)8-6-14(17)10-19-20(13)16-11-15(23(24,25)26)4-5-18(16)27-19/h4-5,11,13-14,17,27H,6-10,12H2,1-3H3,(H,29,30)/t13-,14?,17-/m1/s1 |
| InChIKey | TVPJLXXMAYLKOC-SNVMCYLTSA-N |
| XLogP | 5.29 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|