C12H13Cl2F3N4O — CID 162580082
5,7-dichloro-3-ethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazolo[4,5-d]pyrimidine (PubChem CID 162580082) has the molecular formula C12H13Cl2F3N4O and a molecular weight of 357.16 g/mol. Its IUPAC name is 5,7-dichloro-3-ethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazolo[4,5-d]pyrimidine.
| Compound Name | 5,7-dichloro-3-ethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 162580082 |
| Molecular Formula | C12H13Cl2F3N4O |
| Molecular Weight | 357.16 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 5,7-dichloro-3-ethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazolo[4,5-d]pyrimidine |
| SMILES | CCc1nn(CCCOCC(F)(F)F)c2c(Cl)nc(Cl)nc12 |
| InChI | InChI=1S/C12H13Cl2F3N4O/c1-2-7-8-9(10(13)19-11(14)18-8)21(20-7)4-3-5-22-6-12(15,16)17/h2-6H2,1H3 |
| InChIKey | LQRMUPBFKHZCRW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.16 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|