C27H23F3N2O3S — CID 162580170
2-[5-[[4-[(3S)-hexa-1,5-dien-3-yl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]indol-1-yl]acetic acid (PubChem CID 162580170) has the molecular formula C27H23F3N2O3S and a molecular weight of 512.55 g/mol. Its IUPAC name is 2-[5-[[4-[(3S)-hexa-1,5-dien-3-yl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]indol-1-yl]acetic acid.
| Compound Name | 2-[5-[[4-[(3S)-hexa-1,5-dien-3-yl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 162580170 |
| Molecular Formula | C27H23F3N2O3S |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | 2-[5-[[4-[(3S)-hexa-1,5-dien-3-yl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]indol-1-yl]acetic acid |
| SMILES | C=CC[C@@H](C=C)c1nc(-c2ccc(C(F)(F)F)cc2)sc1COc1ccc2c(ccn2CC(=O)O)c1 |
| InChI | InChI=1S/C27H23F3N2O3S/c1-3-5-17(4-2)25-23(36-26(31-25)18-6-8-20(9-7-18)27(28,29)30)16-35-21-10-11-22-19(14-21)12-13-32(22)15-24(33)34/h3-4,6-14,17H,1-2,5,15-16H2,(H,33,34)/t17-/m1/s1 |
| InChIKey | MDMXBYVGORJSRV-QGZVFWFLSA-N |
| XLogP | 7.29 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|