C16H22F8INO8S — CID 162580268
methyl (2R)-2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]-2-[3-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethyl]sulfonyloxycyclobutyl]acetate (PubChem CID 162580268) has the molecular formula C16H22F8INO8S and a molecular weight of 667.31 g/mol. Its IUPAC name is methyl (2R)-2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]-2-[3-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethyl]sulfonyloxycyclobutyl]acetate.
| Compound Name | methyl (2R)-2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]-2-[3-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethyl]sulfonyloxycyclobutyl]acetate |
|---|---|
| PubChem CID | 162580268 |
| Molecular Formula | C16H22F8INO8S |
| Molecular Weight | 667.31 g/mol |
| Exact Mass | 667.00 |
| IUPAC Name | methyl (2R)-2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]-2-[3-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethyl]sulfonyloxycyclobutyl]acetate |
| SMILES | COC(=O)[C@H](NC(O)OC(C)(C)C)C1CC(OS(=O)(=O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)I)C1 |
| InChI | InChI=1S/C16H22F8INO8S/c1-12(2,3)32-11(28)26-9(10(27)31-4)7-5-8(6-7)33-35(29,30)16(23,24)15(21,22)34-14(19,20)13(17,18)25/h7-9,11,26,28H,5-6H2,1-4H3/t7?,8?,9-,11?/m1/s1 |
| InChIKey | YGGYVBNNCZNADR-CHNYNBFLSA-N |
| XLogP | 3.16 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|