C24H29F3N2O3 — CID 162580386
2-[(1S)-3-(oxan-4-ylimino)-1-propan-2-ylcyclopentanecarbonyl]-7-(trifluoromethyl)-1,3-dihydroisoquinolin-4-one (PubChem CID 162580386) has the molecular formula C24H29F3N2O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is 2-[(1S)-3-(oxan-4-ylimino)-1-propan-2-ylcyclopentanecarbonyl]-7-(trifluoromethyl)-1,3-dihydroisoquinolin-4-one.
| Compound Name | 2-[(1S)-3-(oxan-4-ylimino)-1-propan-2-ylcyclopentanecarbonyl]-7-(trifluoromethyl)-1,3-dihydroisoquinolin-4-one |
|---|---|
| PubChem CID | 162580386 |
| Molecular Formula | C24H29F3N2O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 2-[(1S)-3-(oxan-4-ylimino)-1-propan-2-ylcyclopentanecarbonyl]-7-(trifluoromethyl)-1,3-dihydroisoquinolin-4-one |
| SMILES | CC(C)[C@]1(C(=O)N2CC(=O)c3ccc(C(F)(F)F)cc3C2)CC/C(=N\C2CCOCC2)C1 |
| InChI | InChI=1S/C24H29F3N2O3/c1-15(2)23(8-5-19(12-23)28-18-6-9-32-10-7-18)22(31)29-13-16-11-17(24(25,26)27)3-4-20(16)21(30)14-29/h3-4,11,15,18H,5-10,12-14H2,1-2H3/b28-19+/t23-/m0/s1 |
| InChIKey | GEMLBJMNVSJPMK-FLZWBEAESA-N |
| XLogP | 4.68 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|