C30H27F6N5O2 — CID 162580483
[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-phenyltriazol-4-yl]-[(4S,5R)-5,6-dimethyl-4-phenyl-1,3,6-oxadiazepan-3-yl]methanone (PubChem CID 162580483) has the molecular formula C30H27F6N5O2 and a molecular weight of 603.57 g/mol. Its IUPAC name is [1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-phenyltriazol-4-yl]-[(4S,5R)-5,6-dimethyl-4-phenyl-1,3,6-oxadiazepan-3-yl]methanone.
| Compound Name | [1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-phenyltriazol-4-yl]-[(4S,5R)-5,6-dimethyl-4-phenyl-1,3,6-oxadiazepan-3-yl]methanone |
|---|---|
| PubChem CID | 162580483 |
| Molecular Formula | C30H27F6N5O2 |
| Molecular Weight | 603.57 g/mol |
| Exact Mass | 603.21 |
| IUPAC Name | [1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-phenyltriazol-4-yl]-[(4S,5R)-5,6-dimethyl-4-phenyl-1,3,6-oxadiazepan-3-yl]methanone |
| SMILES | C[C@@H]1[C@H](c2ccccc2)N(C(=O)c2nnn(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2-c2ccccc2)COCN1C |
| InChI | InChI=1S/C30H27F6N5O2/c1-19-26(21-9-5-3-6-10-21)40(18-43-17-39(19)2)28(42)25-27(22-11-7-4-8-12-22)41(38-37-25)16-20-13-23(29(31,32)33)15-24(14-20)30(34,35)36/h3-15,19,26H,16-18H2,1-2H3/t19-,26-/m1/s1 |
| InChIKey | JFROKMVPBFSJSY-NIYFSFCBSA-N |
| XLogP | 6.48 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.57 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |