About 3-(3-fluorocyclohexa-2,4-dien-1-ylidene)-5-(trifluoromethyl)-1,2-dihydropyrazole
3-(3-fluorocyclohexa-2,4-dien-1-ylidene)-5-(trifluoromethyl)-1,2-dihydropyrazole (PubChem CID 162580919) has the molecular formula C10H8F4N2
and a molecular weight of 232.18 g/mol. Its IUPAC name is 3-(3-fluorocyclohexa-2,4-dien-1-ylidene)-5-(trifluoromethyl)-1,2-dihydropyrazole.
Molecular Properties
| Compound Name | 3-(3-fluorocyclohexa-2,4-dien-1-ylidene)-5-(trifluoromethyl)-1,2-dihydropyrazole |
| PubChem CID | 162580919 |
| Molecular Formula | C10H8F4N2 |
| Molecular Weight | 232.18 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 3-(3-fluorocyclohexa-2,4-dien-1-ylidene)-5-(trifluoromethyl)-1,2-dihydropyrazole |
| SMILES | FC1=CC(=C2C=C(C(F)(F)F)NN2)CC=C1 |
| InChI | InChI=1S/C10H8F4N2/c11-7-3-1-2-6(4-7)8-5-9(16-15-8)10(12,13)14/h1,3-5,15-16H,2H2 |
| InChIKey | NWJYWHXVGNREIW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.18 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3-fluorocyclohexa-2,4-dien-1-ylidene)-5-(trifluoromethyl)-1,2-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-fluorocyclohexa-2,4-dien-1-ylidene)-5-(trifluoromethyl)-1,2-dihydropyrazole?
The IUPAC name of 3-(3-fluorocyclohexa-2,4-dien-1-ylidene)-5-(trifluoromethyl)-1,2-dihydropyrazole (CID 162580919) is 3-(3-fluorocyclohexa-2,4-dien-1-ylidene)-5-(trifluoromethyl)-1,2-dihydropyrazole.
What is the SMILES notation for 3-(3-fluorocyclohexa-2,4-dien-1-ylidene)-5-(trifluoromethyl)-1,2-dihydropyrazole?
The canonical SMILES for 3-(3-fluorocyclohexa-2,4-dien-1-ylidene)-5-(trifluoromethyl)-1,2-dihydropyrazole is FC1=CC(=C2C=C(C(F)(F)F)NN2)CC=C1.
What is the InChIKey of 3-(3-fluorocyclohexa-2,4-dien-1-ylidene)-5-(trifluoromethyl)-1,2-dihydropyrazole?
The InChIKey is NWJYWHXVGNREIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F4N2/c11-7-3-1-2-6(4-7)8-5-9(16-15-8)10(12,13)14/h1,3-5,15-16H,2H2.
What are the key properties of 3-(3-fluorocyclohexa-2,4-dien-1-ylidene)-5-(trifluoromethyl)-1,2-dihydropyrazole?
3-(3-fluorocyclohexa-2,4-dien-1-ylidene)-5-(trifluoromethyl)-1,2-dihydropyrazole has a molecular weight of 232.18 g/mol, XLogP of 2.61, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-fluorocyclohexa-2,4-dien-1-ylidene)-5-(trifluoromethyl)-1,2-dihydropyrazole is sourced from PubChem (CID 162580919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).