C20H21F2NO2S — CID 162581041
9-[(E)-1,1-difluorobut-2-enoxy]-5-thiophen-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 162581041) has the molecular formula C20H21F2NO2S and a molecular weight of 377.46 g/mol. Its IUPAC name is 9-[(E)-1,1-difluorobut-2-enoxy]-5-thiophen-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | 9-[(E)-1,1-difluorobut-2-enoxy]-5-thiophen-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 162581041 |
| Molecular Formula | C20H21F2NO2S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 9-[(E)-1,1-difluorobut-2-enoxy]-5-thiophen-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | C/C=C/C(F)(F)Oc1ccc2c(c1)C1OCCCC1C(c1cccs1)N2 |
| InChI | InChI=1S/C20H21F2NO2S/c1-2-9-20(21,22)25-13-7-8-16-15(12-13)19-14(5-3-10-24-19)18(23-16)17-6-4-11-26-17/h2,4,6-9,11-12,14,18-19,23H,3,5,10H2,1H3/b9-2+ |
| InChIKey | CLJFULVXOPKECW-XNWCZRBMSA-N |
| XLogP | 5.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|