C26H22Cl2F3NO2 — CID 162581522
2-[12-(2,4-dichlorophenyl)-11-methyl-9-(trifluoromethyl)-1,2,3,4,6,11-hexahydroindolo[1,2-b]isoquinolin-4-yl]acetic acid (PubChem CID 162581522) has the molecular formula C26H22Cl2F3NO2 and a molecular weight of 508.37 g/mol. Its IUPAC name is 2-[12-(2,4-dichlorophenyl)-11-methyl-9-(trifluoromethyl)-1,2,3,4,6,11-hexahydroindolo[1,2-b]isoquinolin-4-yl]acetic acid.
| Compound Name | 2-[12-(2,4-dichlorophenyl)-11-methyl-9-(trifluoromethyl)-1,2,3,4,6,11-hexahydroindolo[1,2-b]isoquinolin-4-yl]acetic acid |
|---|---|
| PubChem CID | 162581522 |
| Molecular Formula | C26H22Cl2F3NO2 |
| Molecular Weight | 508.37 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | 2-[12-(2,4-dichlorophenyl)-11-methyl-9-(trifluoromethyl)-1,2,3,4,6,11-hexahydroindolo[1,2-b]isoquinolin-4-yl]acetic acid |
| SMILES | CC1c2cc(C(F)(F)F)ccc2Cn2c3c(c(-c4ccc(Cl)cc4Cl)c21)CCCC3CC(=O)O |
| InChI | InChI=1S/C26H22Cl2F3NO2/c1-13-20-10-16(26(29,30)31)6-5-15(20)12-32-24(13)23(18-8-7-17(27)11-21(18)28)19-4-2-3-14(25(19)32)9-22(33)34/h5-8,10-11,13-14H,2-4,9,12H2,1H3,(H,33,34) |
| InChIKey | PPSUOZUJKSZWIK-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.37 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |