About (3R)-2-methyl-3-(trifluoromethyl)-2,3-dihydropyridin-5-amine
(3R)-2-methyl-3-(trifluoromethyl)-2,3-dihydropyridin-5-amine (PubChem CID 162581739) has the molecular formula C7H9F3N2
and a molecular weight of 178.16 g/mol. Its IUPAC name is (3R)-2-methyl-3-(trifluoromethyl)-2,3-dihydropyridin-5-amine.
Molecular Properties
| Compound Name | (3R)-2-methyl-3-(trifluoromethyl)-2,3-dihydropyridin-5-amine |
| PubChem CID | 162581739 |
| Molecular Formula | C7H9F3N2 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | (3R)-2-methyl-3-(trifluoromethyl)-2,3-dihydropyridin-5-amine |
| SMILES | CC1N=CC(N)=C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C7H9F3N2/c1-4-6(7(8,9)10)2-5(11)3-12-4/h2-4,6H,11H2,1H3/t4?,6-/m1/s1 |
| InChIKey | CHTXYPZPHGPVJR-BAFYGKSASA-N |
| XLogP | 1.48 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-2-methyl-3-(trifluoromethyl)-2,3-dihydropyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2-methyl-3-(trifluoromethyl)-2,3-dihydropyridin-5-amine?
The IUPAC name of (3R)-2-methyl-3-(trifluoromethyl)-2,3-dihydropyridin-5-amine (CID 162581739) is (3R)-2-methyl-3-(trifluoromethyl)-2,3-dihydropyridin-5-amine.
What is the SMILES notation for (3R)-2-methyl-3-(trifluoromethyl)-2,3-dihydropyridin-5-amine?
The canonical SMILES for (3R)-2-methyl-3-(trifluoromethyl)-2,3-dihydropyridin-5-amine is CC1N=CC(N)=C[C@H]1C(F)(F)F.
What is the InChIKey of (3R)-2-methyl-3-(trifluoromethyl)-2,3-dihydropyridin-5-amine?
The InChIKey is CHTXYPZPHGPVJR-BAFYGKSASA-N. The full InChI is InChI=1S/C7H9F3N2/c1-4-6(7(8,9)10)2-5(11)3-12-4/h2-4,6H,11H2,1H3/t4?,6-/m1/s1.
What are the key properties of (3R)-2-methyl-3-(trifluoromethyl)-2,3-dihydropyridin-5-amine?
(3R)-2-methyl-3-(trifluoromethyl)-2,3-dihydropyridin-5-amine has a molecular weight of 178.16 g/mol, XLogP of 1.48, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2-methyl-3-(trifluoromethyl)-2,3-dihydropyridin-5-amine is sourced from PubChem (CID 162581739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).