C12H17F3N2O — CID 162581895
2,2,2-trifluoro-N-[(1Z,3Z)-penta-1,3-dienyl]-N-[[(2S)-pyrrolidin-2-yl]methyl]acetamide (PubChem CID 162581895) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1Z,3Z)-penta-1,3-dienyl]-N-[[(2S)-pyrrolidin-2-yl]methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(1Z,3Z)-penta-1,3-dienyl]-N-[[(2S)-pyrrolidin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 162581895 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1Z,3Z)-penta-1,3-dienyl]-N-[[(2S)-pyrrolidin-2-yl]methyl]acetamide |
| SMILES | C/C=C\C=C/N(C[C@@H]1CCCN1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O/c1-2-3-4-8-17(11(18)12(13,14)15)9-10-6-5-7-16-10/h2-4,8,10,16H,5-7,9H2,1H3/b3-2-,8-4-/t10-/m0/s1 |
| InChIKey | DCHBVGSQAIIUJM-CGJBAMLBSA-N |
| XLogP | 2.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|