C26H24F4N8O3 — CID 162582266
4-N-[(1S)-5-(1,4-dimethyltetrazol-5-ylidene)-1,2,3,4-tetrahydroinden-1-yl]-6-N-[[4-fluoro-3-(trifluoromethoxy)phenyl]methyl]pyrimidine-4,6-dicarboxamide (PubChem CID 162582266) has the molecular formula C26H24F4N8O3 and a molecular weight of 572.52 g/mol. Its IUPAC name is 4-N-[(1S)-5-(1,4-dimethyltetrazol-5-ylidene)-1,2,3,4-tetrahydroinden-1-yl]-6-N-[[4-fluoro-3-(trifluoromethoxy)phenyl]methyl]pyrimidine-4,6-dicarboxamide.
| Compound Name | 4-N-[(1S)-5-(1,4-dimethyltetrazol-5-ylidene)-1,2,3,4-tetrahydroinden-1-yl]-6-N-[[4-fluoro-3-(trifluoromethoxy)phenyl]methyl]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 162582266 |
| Molecular Formula | C26H24F4N8O3 |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | 4-N-[(1S)-5-(1,4-dimethyltetrazol-5-ylidene)-1,2,3,4-tetrahydroinden-1-yl]-6-N-[[4-fluoro-3-(trifluoromethoxy)phenyl]methyl]pyrimidine-4,6-dicarboxamide |
| SMILES | CN1N=NN(C)C1=C1C=CC2=C(CC[C@@H]2NC(=O)c2cc(C(=O)NCc3ccc(F)c(OC(F)(F)F)c3)ncn2)C1 |
| InChI | InChI=1S/C26H24F4N8O3/c1-37-25(38(2)36-35-37)16-4-6-17-15(10-16)5-8-19(17)34-24(40)21-11-20(32-13-33-21)23(39)31-12-14-3-7-18(27)22(9-14)41-26(28,29)30/h3-4,6-7,9,11,13,19H,5,8,10,12H2,1-2H3,(H,31,39)(H,34,40)/t19-/m0/s1 |
| InChIKey | SZHWGQKATOGDDM-IBGZPJMESA-N |
| XLogP | 3.96 |
| TPSA | 124.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |