C19H19F3N2O2 — CID 162582567
1,1,1-trifluoro-2-(1H-indazol-5-yl)-3-(2,4,6-trimethylphenoxy)propan-2-ol (PubChem CID 162582567) has the molecular formula C19H19F3N2O2 and a molecular weight of 364.37 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(1H-indazol-5-yl)-3-(2,4,6-trimethylphenoxy)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(1H-indazol-5-yl)-3-(2,4,6-trimethylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 162582567 |
| Molecular Formula | C19H19F3N2O2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1,1,1-trifluoro-2-(1H-indazol-5-yl)-3-(2,4,6-trimethylphenoxy)propan-2-ol |
| SMILES | Cc1cc(C)c(OCC(O)(c2ccc3[nH]ncc3c2)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C19H19F3N2O2/c1-11-6-12(2)17(13(3)7-11)26-10-18(25,19(20,21)22)15-4-5-16-14(8-15)9-23-24-16/h4-9,25H,10H2,1-3H3,(H,23,24) |
| InChIKey | ZNVPFLPRXLSIFN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |