About N-methyl-4-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfonamide
N-methyl-4-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfonamide (PubChem CID 162582621) has the molecular formula C8H10F3NO2S
and a molecular weight of 241.23 g/mol. Its IUPAC name is N-methyl-4-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfonamide.
Molecular Properties
| Compound Name | N-methyl-4-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfonamide |
| PubChem CID | 162582621 |
| Molecular Formula | C8H10F3NO2S |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | N-methyl-4-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfonamide |
| SMILES | CNS(=O)(=O)C1C=CC(C(F)(F)F)=CC1 |
| InChI | InChI=1S/C8H10F3NO2S/c1-12-15(13,14)7-4-2-6(3-5-7)8(9,10)11/h2-4,7,12H,5H2,1H3 |
| InChIKey | YURUMVVJRNVAMU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-4-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfonamide?
The IUPAC name of N-methyl-4-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfonamide (CID 162582621) is N-methyl-4-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfonamide.
What is the SMILES notation for N-methyl-4-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfonamide?
The canonical SMILES for N-methyl-4-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfonamide is CNS(=O)(=O)C1C=CC(C(F)(F)F)=CC1.
What is the InChIKey of N-methyl-4-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfonamide?
The InChIKey is YURUMVVJRNVAMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3NO2S/c1-12-15(13,14)7-4-2-6(3-5-7)8(9,10)11/h2-4,7,12H,5H2,1H3.
What are the key properties of N-methyl-4-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfonamide?
N-methyl-4-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfonamide has a molecular weight of 241.23 g/mol, XLogP of 1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfonamide is sourced from PubChem (CID 162582621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).