C20H14Cl2F3N3O — CID 162582622
7-(4-chlorocyclohexa-1,3-dien-1-yl)-6-(2-chlorophenyl)-3-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 162582622) has the molecular formula C20H14Cl2F3N3O and a molecular weight of 440.25 g/mol. Its IUPAC name is 7-(4-chlorocyclohexa-1,3-dien-1-yl)-6-(2-chlorophenyl)-3-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 7-(4-chlorocyclohexa-1,3-dien-1-yl)-6-(2-chlorophenyl)-3-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 162582622 |
| Molecular Formula | C20H14Cl2F3N3O |
| Molecular Weight | 440.25 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 7-(4-chlorocyclohexa-1,3-dien-1-yl)-6-(2-chlorophenyl)-3-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | FC(F)(F)COc1nnc2cc(C3=CC=C(Cl)CC3)c(-c3ccccc3Cl)cn12 |
| InChI | InChI=1S/C20H14Cl2F3N3O/c21-13-7-5-12(6-8-13)15-9-18-26-27-19(29-11-20(23,24)25)28(18)10-16(15)14-3-1-2-4-17(14)22/h1-5,7,9-10H,6,8,11H2 |
| InChIKey | VHVWOHBLOSIVCU-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.25 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |