C27H26F4IN7O2 — CID 162582841
(11S)-N-[4-fluoro-3-(trifluoromethyl)phenyl]-11-(1-iodopropan-2-yl)-N-methyl-10-oxo-3,6,9,12,20,21-hexazatetracyclo[11.7.1.03,8.014,19]henicosa-1(20),8,13(21),14,16,18-hexaene-6-carboxamide (PubChem CID 162582841) has the molecular formula C27H26F4IN7O2 and a molecular weight of 683.45 g/mol. Its IUPAC name is (11S)-N-[4-fluoro-3-(trifluoromethyl)phenyl]-11-(1-iodopropan-2-yl)-N-methyl-10-oxo-3,6,9,12,20,21-hexazatetracyclo[11.7.1.03,8.014,19]henicosa-1(20),8,13(21),14,16,18-hexaene-6-carboxamide.
| Compound Name | (11S)-N-[4-fluoro-3-(trifluoromethyl)phenyl]-11-(1-iodopropan-2-yl)-N-methyl-10-oxo-3,6,9,12,20,21-hexazatetracyclo[11.7.1.03,8.014,19]henicosa-1(20),8,13(21),14,16,18-hexaene-6-carboxamide |
|---|---|
| PubChem CID | 162582841 |
| Molecular Formula | C27H26F4IN7O2 |
| Molecular Weight | 683.45 g/mol |
| Exact Mass | 683.11 |
| IUPAC Name | (11S)-N-[4-fluoro-3-(trifluoromethyl)phenyl]-11-(1-iodopropan-2-yl)-N-methyl-10-oxo-3,6,9,12,20,21-hexazatetracyclo[11.7.1.03,8.014,19]henicosa-1(20),8,13(21),14,16,18-hexaene-6-carboxamide |
| SMILES | CC(CI)[C@@H]1Nc2nc(nc3ccccc23)CN2CCN(C(=O)N(C)c3ccc(F)c(C(F)(F)F)c3)C/C2=N\C1=O |
| InChI | InChI=1S/C27H26F4IN7O2/c1-15(12-32)23-25(40)35-22-14-39(26(41)37(2)16-7-8-19(28)18(11-16)27(29,30)31)10-9-38(22)13-21-33-20-6-4-3-5-17(20)24(34-21)36-23/h3-8,11,15,23H,9-10,12-14H2,1-2H3,(H,33,34,36)/b35-22+/t15?,23-/m0/s1 |
| InChIKey | HOFDAOALVGTUHM-SMIHPPGISA-N |
| XLogP | 4.95 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|