C31H36F3N5O4S — CID 162582891
5-[2-[[(2Z,4E)-6-(3-morpholin-4-ylpropoxy)hepta-2,4-dien-4-yl]amino]pyrimidin-4-yl]-N-[[3-(trifluoromethoxy)phenyl]methyl]thiophene-2-carboxamide (PubChem CID 162582891) has the molecular formula C31H36F3N5O4S and a molecular weight of 631.72 g/mol. Its IUPAC name is 5-[2-[[(2Z,4E)-6-(3-morpholin-4-ylpropoxy)hepta-2,4-dien-4-yl]amino]pyrimidin-4-yl]-N-[[3-(trifluoromethoxy)phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-[2-[[(2Z,4E)-6-(3-morpholin-4-ylpropoxy)hepta-2,4-dien-4-yl]amino]pyrimidin-4-yl]-N-[[3-(trifluoromethoxy)phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 162582891 |
| Molecular Formula | C31H36F3N5O4S |
| Molecular Weight | 631.72 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | 5-[2-[[(2Z,4E)-6-(3-morpholin-4-ylpropoxy)hepta-2,4-dien-4-yl]amino]pyrimidin-4-yl]-N-[[3-(trifluoromethoxy)phenyl]methyl]thiophene-2-carboxamide |
| SMILES | C/C=C\C(=C/C(C)OCCCN1CCOCC1)Nc1nccc(-c2ccc(C(=O)NCc3cccc(OC(F)(F)F)c3)s2)n1 |
| InChI | InChI=1S/C31H36F3N5O4S/c1-3-6-24(19-22(2)42-16-5-13-39-14-17-41-18-15-39)37-30-35-12-11-26(38-30)27-9-10-28(44-27)29(40)36-21-23-7-4-8-25(20-23)43-31(32,33)34/h3-4,6-12,19-20,22H,5,13-18,21H2,1-2H3,(H,36,40)(H,35,37,38)/b6-3-,24-19+ |
| InChIKey | KWQKZKMOMMRSQC-JMHFLRCYSA-N |
| XLogP | 6.03 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.72 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|