About 5-(3,3-difluoropyrrolidin-1-yl)-2-iodo-1H-imidazo[4,5-b]pyridine
5-(3,3-difluoropyrrolidin-1-yl)-2-iodo-1H-imidazo[4,5-b]pyridine (PubChem CID 162583240) has the molecular formula C10H9F2IN4
and a molecular weight of 350.11 g/mol. Its IUPAC name is 5-(3,3-difluoropyrrolidin-1-yl)-2-iodo-1H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 5-(3,3-difluoropyrrolidin-1-yl)-2-iodo-1H-imidazo[4,5-b]pyridine |
| PubChem CID | 162583240 |
| Molecular Formula | C10H9F2IN4 |
| Molecular Weight | 350.11 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 5-(3,3-difluoropyrrolidin-1-yl)-2-iodo-1H-imidazo[4,5-b]pyridine |
| SMILES | FC1(F)CCN(c2ccc3[nH]c(I)nc3n2)C1 |
| InChI | InChI=1S/C10H9F2IN4/c11-10(12)3-4-17(5-10)7-2-1-6-8(15-7)16-9(13)14-6/h1-2H,3-5H2,(H,14,15,16) |
| InChIKey | IIFPYGDPIKKSCP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.11 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,3-difluoropyrrolidin-1-yl)-2-iodo-1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,3-difluoropyrrolidin-1-yl)-2-iodo-1H-imidazo[4,5-b]pyridine?
The IUPAC name of 5-(3,3-difluoropyrrolidin-1-yl)-2-iodo-1H-imidazo[4,5-b]pyridine (CID 162583240) is 5-(3,3-difluoropyrrolidin-1-yl)-2-iodo-1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for 5-(3,3-difluoropyrrolidin-1-yl)-2-iodo-1H-imidazo[4,5-b]pyridine?
The canonical SMILES for 5-(3,3-difluoropyrrolidin-1-yl)-2-iodo-1H-imidazo[4,5-b]pyridine is FC1(F)CCN(c2ccc3[nH]c(I)nc3n2)C1.
What is the InChIKey of 5-(3,3-difluoropyrrolidin-1-yl)-2-iodo-1H-imidazo[4,5-b]pyridine?
The InChIKey is IIFPYGDPIKKSCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2IN4/c11-10(12)3-4-17(5-10)7-2-1-6-8(15-7)16-9(13)14-6/h1-2H,3-5H2,(H,14,15,16).
What are the key properties of 5-(3,3-difluoropyrrolidin-1-yl)-2-iodo-1H-imidazo[4,5-b]pyridine?
5-(3,3-difluoropyrrolidin-1-yl)-2-iodo-1H-imidazo[4,5-b]pyridine has a molecular weight of 350.11 g/mol, XLogP of 2.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,3-difluoropyrrolidin-1-yl)-2-iodo-1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 162583240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).