C22H24ClF5N6O4 — CID 162583295
4-[3-[4-[5-chloro-7-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-3,5-difluorophenoxy]propyl-methylamino]-4-hydroxybutanoic acid (PubChem CID 162583295) has the molecular formula C22H24ClF5N6O4 and a molecular weight of 566.92 g/mol. Its IUPAC name is 4-[3-[4-[5-chloro-7-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-3,5-difluorophenoxy]propyl-methylamino]-4-hydroxybutanoic acid.
| Compound Name | 4-[3-[4-[5-chloro-7-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-3,5-difluorophenoxy]propyl-methylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 162583295 |
| Molecular Formula | C22H24ClF5N6O4 |
| Molecular Weight | 566.92 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | 4-[3-[4-[5-chloro-7-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-3,5-difluorophenoxy]propyl-methylamino]-4-hydroxybutanoic acid |
| SMILES | C[C@H](Nc1c(-c2c(F)cc(OCCCN(C)C(O)CCC(=O)O)cc2F)c(Cl)nc2ncnn12)C(F)(F)F |
| InChI | InChI=1S/C22H24ClF5N6O4/c1-11(22(26,27)28)31-20-18(19(23)32-21-29-10-30-34(20)21)17-13(24)8-12(9-14(17)25)38-7-3-6-33(2)15(35)4-5-16(36)37/h8-11,15,31,35H,3-7H2,1-2H3,(H,36,37)/t11-,15?/m0/s1 |
| InChIKey | JGQZEDNHWDSGGU-VPHXOMNUSA-N |
| XLogP | 3.97 |
| TPSA | 125.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.92 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|