C18H26F3NO3 — CID 162583373
tert-butyl N-[(E,2S)-1-hydroxy-3-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]hex-4-en-2-yl]carbamate (PubChem CID 162583373) has the molecular formula C18H26F3NO3 and a molecular weight of 361.40 g/mol. Its IUPAC name is tert-butyl N-[(E,2S)-1-hydroxy-3-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]hex-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2S)-1-hydroxy-3-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]hex-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 162583373 |
| Molecular Formula | C18H26F3NO3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | tert-butyl N-[(E,2S)-1-hydroxy-3-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]hex-4-en-2-yl]carbamate |
| SMILES | C/C=C/C(C1=CCC(C(F)(F)F)C=C1)[C@@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26F3NO3/c1-5-6-14(12-7-9-13(10-8-12)18(19,20)21)15(11-23)22-16(24)25-17(2,3)4/h5-9,13-15,23H,10-11H2,1-4H3,(H,22,24)/b6-5+/t13?,14?,15-/m1/s1 |
| InChIKey | KODLXRRTJCZBHF-NELHYYLHSA-N |
| XLogP | 4.13 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|