C15H21F3N6 — CID 162583623
N'-[5-[[(2E,4Z)-5-(dimethylamino)-2-ethylpenta-2,4-dienyl]amino]pyrazin-2-yl]-2,2,2-trifluoroethanimidamide (PubChem CID 162583623) has the molecular formula C15H21F3N6 and a molecular weight of 342.37 g/mol. Its IUPAC name is N'-[5-[[(2E,4Z)-5-(dimethylamino)-2-ethylpenta-2,4-dienyl]amino]pyrazin-2-yl]-2,2,2-trifluoroethanimidamide.
| Compound Name | N'-[5-[[(2E,4Z)-5-(dimethylamino)-2-ethylpenta-2,4-dienyl]amino]pyrazin-2-yl]-2,2,2-trifluoroethanimidamide |
|---|---|
| PubChem CID | 162583623 |
| Molecular Formula | C15H21F3N6 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | N'-[5-[[(2E,4Z)-5-(dimethylamino)-2-ethylpenta-2,4-dienyl]amino]pyrazin-2-yl]-2,2,2-trifluoroethanimidamide |
| SMILES | CC/C(=C\C=C/N(C)C)CNc1cnc(/N=C(\N)C(F)(F)F)cn1 |
| InChI | InChI=1S/C15H21F3N6/c1-4-11(6-5-7-24(2)3)8-20-12-9-22-13(10-21-12)23-14(19)15(16,17)18/h5-7,9-10H,4,8H2,1-3H3,(H,20,21)(H2,19,22,23)/b7-5-,11-6+ |
| InChIKey | GFKFMJPTMNSMAT-LAVHUSFLSA-N |
| XLogP | 2.85 |
| TPSA | 79.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|