About 6-(1,1-difluoroethyl)-4-fluoro-2-methyl-5-propan-2-yl-2,3-dihydropyridine
6-(1,1-difluoroethyl)-4-fluoro-2-methyl-5-propan-2-yl-2,3-dihydropyridine (PubChem CID 162583642) has the molecular formula C11H16F3N
and a molecular weight of 219.25 g/mol. Its IUPAC name is 6-(1,1-difluoroethyl)-4-fluoro-2-methyl-5-propan-2-yl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 6-(1,1-difluoroethyl)-4-fluoro-2-methyl-5-propan-2-yl-2,3-dihydropyridine |
| PubChem CID | 162583642 |
| Molecular Formula | C11H16F3N |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 6-(1,1-difluoroethyl)-4-fluoro-2-methyl-5-propan-2-yl-2,3-dihydropyridine |
| SMILES | CC1CC(F)=C(C(C)C)C(C(C)(F)F)=N1 |
| InChI | InChI=1S/C11H16F3N/c1-6(2)9-8(12)5-7(3)15-10(9)11(4,13)14/h6-7H,5H2,1-4H3 |
| InChIKey | FRJGXKRSILTRRU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(1,1-difluoroethyl)-4-fluoro-2-methyl-5-propan-2-yl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,1-difluoroethyl)-4-fluoro-2-methyl-5-propan-2-yl-2,3-dihydropyridine?
The IUPAC name of 6-(1,1-difluoroethyl)-4-fluoro-2-methyl-5-propan-2-yl-2,3-dihydropyridine (CID 162583642) is 6-(1,1-difluoroethyl)-4-fluoro-2-methyl-5-propan-2-yl-2,3-dihydropyridine.
What is the SMILES notation for 6-(1,1-difluoroethyl)-4-fluoro-2-methyl-5-propan-2-yl-2,3-dihydropyridine?
The canonical SMILES for 6-(1,1-difluoroethyl)-4-fluoro-2-methyl-5-propan-2-yl-2,3-dihydropyridine is CC1CC(F)=C(C(C)C)C(C(C)(F)F)=N1.
What is the InChIKey of 6-(1,1-difluoroethyl)-4-fluoro-2-methyl-5-propan-2-yl-2,3-dihydropyridine?
The InChIKey is FRJGXKRSILTRRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3N/c1-6(2)9-8(12)5-7(3)15-10(9)11(4,13)14/h6-7H,5H2,1-4H3.
What are the key properties of 6-(1,1-difluoroethyl)-4-fluoro-2-methyl-5-propan-2-yl-2,3-dihydropyridine?
6-(1,1-difluoroethyl)-4-fluoro-2-methyl-5-propan-2-yl-2,3-dihydropyridine has a molecular weight of 219.25 g/mol, XLogP of 3.75, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,1-difluoroethyl)-4-fluoro-2-methyl-5-propan-2-yl-2,3-dihydropyridine is sourced from PubChem (CID 162583642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).