C26H27F6NO2 — CID 162583969
(2R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-methyl-1-(4-methylphenyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 162583969) has the molecular formula C26H27F6NO2 and a molecular weight of 499.50 g/mol. Its IUPAC name is (2R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-methyl-1-(4-methylphenyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (2R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-methyl-1-(4-methylphenyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 162583969 |
| Molecular Formula | C26H27F6NO2 |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | (2R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-methyl-1-(4-methylphenyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | Cc1ccc(C2C3CC(C)CC(=O)N3C[C@@H]2O[C@H](C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C26H27F6NO2/c1-14-4-6-17(7-5-14)24-21-8-15(2)9-23(34)33(21)13-22(24)35-16(3)18-10-19(25(27,28)29)12-20(11-18)26(30,31)32/h4-7,10-12,15-16,21-22,24H,8-9,13H2,1-3H3/t15?,16-,21?,22+,24?/m1/s1 |
| InChIKey | PCJHKNBRIIBKAA-UJUGERDOSA-N |
| XLogP | 6.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |