C19H32F3NO2 — CID 162584362
N-[[(1S)-8-ethyl-3,7-dimethyl-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl]oxy]-N-(1,1,1-trifluoro-2-methylbutan-2-yl)hydroxylamine (PubChem CID 162584362) has the molecular formula C19H32F3NO2 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-[[(1S)-8-ethyl-3,7-dimethyl-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl]oxy]-N-(1,1,1-trifluoro-2-methylbutan-2-yl)hydroxylamine.
| Compound Name | N-[[(1S)-8-ethyl-3,7-dimethyl-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl]oxy]-N-(1,1,1-trifluoro-2-methylbutan-2-yl)hydroxylamine |
|---|---|
| PubChem CID | 162584362 |
| Molecular Formula | C19H32F3NO2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | N-[[(1S)-8-ethyl-3,7-dimethyl-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl]oxy]-N-(1,1,1-trifluoro-2-methylbutan-2-yl)hydroxylamine |
| SMILES | CCC1C(C)CCC2=CC(C)C[C@H](ON(O)C(C)(CC)C(F)(F)F)C21 |
| InChI | InChI=1S/C19H32F3NO2/c1-6-15-13(4)8-9-14-10-12(3)11-16(17(14)15)25-23(24)18(5,7-2)19(20,21)22/h10,12-13,15-17,24H,6-9,11H2,1-5H3/t12?,13?,15?,16-,17?,18?/m0/s1 |
| InChIKey | WTAXRNPEOUAXII-DCVRSWAJSA-N |
| XLogP | 5.75 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|