C27H31ClF3NO7S2 — CID 162584430
3-[5-chloro-2-methyl-4-[(2E,4Z)-1-methylsulfonylhepta-2,4,6-trien-3-yl]phenyl]-4-hydroxy-9-(4,4,4-trifluorobutylsulfonyl)-1-oxa-9-azaspiro[4.5]dec-3-en-2-one (PubChem CID 162584430) has the molecular formula C27H31ClF3NO7S2 and a molecular weight of 638.13 g/mol. Its IUPAC name is 3-[5-chloro-2-methyl-4-[(2E,4Z)-1-methylsulfonylhepta-2,4,6-trien-3-yl]phenyl]-4-hydroxy-9-(4,4,4-trifluorobutylsulfonyl)-1-oxa-9-azaspiro[4.5]dec-3-en-2-one.
| Compound Name | 3-[5-chloro-2-methyl-4-[(2E,4Z)-1-methylsulfonylhepta-2,4,6-trien-3-yl]phenyl]-4-hydroxy-9-(4,4,4-trifluorobutylsulfonyl)-1-oxa-9-azaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 162584430 |
| Molecular Formula | C27H31ClF3NO7S2 |
| Molecular Weight | 638.13 g/mol |
| Exact Mass | 637.12 |
| IUPAC Name | 3-[5-chloro-2-methyl-4-[(2E,4Z)-1-methylsulfonylhepta-2,4,6-trien-3-yl]phenyl]-4-hydroxy-9-(4,4,4-trifluorobutylsulfonyl)-1-oxa-9-azaspiro[4.5]dec-3-en-2-one |
| SMILES | C=C/C=C\C(=C/CS(C)(=O)=O)c1cc(C)c(C2=C(O)C3(CCCN(S(=O)(=O)CCCC(F)(F)F)C3)OC2=O)cc1Cl |
| InChI | InChI=1S/C27H31ClF3NO7S2/c1-4-5-8-19(9-14-40(3,35)36)21-15-18(2)20(16-22(21)28)23-24(33)26(39-25(23)34)10-6-12-32(17-26)41(37,38)13-7-11-27(29,30)31/h4-5,8-9,15-16,33H,1,6-7,10-14,17H2,2-3H3/b8-5-,19-9+ |
| InChIKey | FNNQUPCAWIVOFA-IPQOHRGYSA-N |
| XLogP | 5.15 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.13 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|