C16H13F4NO4S — CID 162584657
6-fluoro-9,9-dimethyl-3-nitro-2-(trifluoromethyl)-3,4-dihydrothioxanthene 10,10-dioxide (PubChem CID 162584657) has the molecular formula C16H13F4NO4S and a molecular weight of 391.34 g/mol. Its IUPAC name is 6-fluoro-9,9-dimethyl-3-nitro-2-(trifluoromethyl)-3,4-dihydrothioxanthene 10,10-dioxide.
| Compound Name | 6-fluoro-9,9-dimethyl-3-nitro-2-(trifluoromethyl)-3,4-dihydrothioxanthene 10,10-dioxide |
|---|---|
| PubChem CID | 162584657 |
| Molecular Formula | C16H13F4NO4S |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 6-fluoro-9,9-dimethyl-3-nitro-2-(trifluoromethyl)-3,4-dihydrothioxanthene 10,10-dioxide |
| SMILES | CC1(C)C2=C(CC([N+](=O)[O-])C(C(F)(F)F)=C2)S(=O)(=O)c2cc(F)ccc21 |
| InChI | InChI=1S/C16H13F4NO4S/c1-15(2)9-4-3-8(17)5-13(9)26(24,25)14-7-12(21(22)23)10(6-11(14)15)16(18,19)20/h3-6,12H,7H2,1-2H3 |
| InChIKey | AIJBRDFFCLIZJF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|