C21H21F2N3O — CID 162584943
(3S)-5-[3-(1,1-difluoroethyl)phenyl]-2'-methyliminospiro[1,2-dihydroindene-3,6'-1,3-diazinane]-4'-one (PubChem CID 162584943) has the molecular formula C21H21F2N3O and a molecular weight of 369.42 g/mol. Its IUPAC name is (3S)-5-[3-(1,1-difluoroethyl)phenyl]-2'-methyliminospiro[1,2-dihydroindene-3,6'-1,3-diazinane]-4'-one.
| Compound Name | (3S)-5-[3-(1,1-difluoroethyl)phenyl]-2'-methyliminospiro[1,2-dihydroindene-3,6'-1,3-diazinane]-4'-one |
|---|---|
| PubChem CID | 162584943 |
| Molecular Formula | C21H21F2N3O |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (3S)-5-[3-(1,1-difluoroethyl)phenyl]-2'-methyliminospiro[1,2-dihydroindene-3,6'-1,3-diazinane]-4'-one |
| SMILES | C/N=C1\NC(=O)C[C@]2(CCc3ccc(-c4cccc(C(C)(F)F)c4)cc32)N1 |
| InChI | InChI=1S/C21H21F2N3O/c1-20(22,23)16-5-3-4-14(10-16)15-7-6-13-8-9-21(17(13)11-15)12-18(27)25-19(24-2)26-21/h3-7,10-11H,8-9,12H2,1-2H3,(H2,24,25,26,27)/t21-/m0/s1 |
| InChIKey | HABFLSPQPODVIV-NRFANRHFSA-N |
| XLogP | 3.70 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|