C20H18F4N2O — CID 162585614
4-(4-fluorophenyl)-6-methyl-4-prop-2-enyl-3-(2,2,2-trifluoroethyl)-1H-quinazolin-2-one (PubChem CID 162585614) has the molecular formula C20H18F4N2O and a molecular weight of 378.37 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-6-methyl-4-prop-2-enyl-3-(2,2,2-trifluoroethyl)-1H-quinazolin-2-one.
| Compound Name | 4-(4-fluorophenyl)-6-methyl-4-prop-2-enyl-3-(2,2,2-trifluoroethyl)-1H-quinazolin-2-one |
|---|---|
| PubChem CID | 162585614 |
| Molecular Formula | C20H18F4N2O |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 4-(4-fluorophenyl)-6-methyl-4-prop-2-enyl-3-(2,2,2-trifluoroethyl)-1H-quinazolin-2-one |
| SMILES | C=CCC1(c2ccc(F)cc2)c2cc(C)ccc2NC(=O)N1CC(F)(F)F |
| InChI | InChI=1S/C20H18F4N2O/c1-3-10-19(14-5-7-15(21)8-6-14)16-11-13(2)4-9-17(16)25-18(27)26(19)12-20(22,23)24/h3-9,11H,1,10,12H2,2H3,(H,25,27) |
| InChIKey | BIVXRCDEUDTHOG-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|