About ethyl (1R)-1-amino-3,3-difluorocyclopentane-1-carboxylate
ethyl (1R)-1-amino-3,3-difluorocyclopentane-1-carboxylate (PubChem CID 162586046) has the molecular formula C8H13F2NO2
and a molecular weight of 193.19 g/mol. Its IUPAC name is ethyl (1R)-1-amino-3,3-difluorocyclopentane-1-carboxylate.
Analyze ethyl (1R)-1-amino-3,3-difluorocyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (1R)-1-amino-3,3-difluorocyclopentane-1-carboxylate?
The IUPAC name of ethyl (1R)-1-amino-3,3-difluorocyclopentane-1-carboxylate (CID 162586046) is ethyl (1R)-1-amino-3,3-difluorocyclopentane-1-carboxylate.
What is the SMILES notation for ethyl (1R)-1-amino-3,3-difluorocyclopentane-1-carboxylate?
The canonical SMILES for ethyl (1R)-1-amino-3,3-difluorocyclopentane-1-carboxylate is CCOC(=O)[C@@]1(N)CCC(F)(F)C1.
What is the InChIKey of ethyl (1R)-1-amino-3,3-difluorocyclopentane-1-carboxylate?
The InChIKey is BGDZSYZHWCEISA-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H13F2NO2/c1-2-13-6(12)7(11)3-4-8(9,10)5-7/h2-5,11H2,1H3/t7-/m1/s1.
What are the key properties of ethyl (1R)-1-amino-3,3-difluorocyclopentane-1-carboxylate?
ethyl (1R)-1-amino-3,3-difluorocyclopentane-1-carboxylate has a molecular weight of 193.19 g/mol, XLogP of 1.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (1R)-1-amino-3,3-difluorocyclopentane-1-carboxylate is sourced from PubChem (CID 162586046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).