C38H45F3N6O5S — CID 162586255
ethyl (E)-2-[5-[6-(ethylcarbamoylamino)-4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-3-pyridinyl]-2-[1-[1-(2-morpholin-4-ylethyl)piperidin-3-yl]ethenyl]benzoyl]but-2-enoate (PubChem CID 162586255) has the molecular formula C38H45F3N6O5S and a molecular weight of 754.88 g/mol. Its IUPAC name is ethyl (E)-2-[5-[6-(ethylcarbamoylamino)-4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-3-pyridinyl]-2-[1-[1-(2-morpholin-4-ylethyl)piperidin-3-yl]ethenyl]benzoyl]but-2-enoate.
| Compound Name | ethyl (E)-2-[5-[6-(ethylcarbamoylamino)-4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-3-pyridinyl]-2-[1-[1-(2-morpholin-4-ylethyl)piperidin-3-yl]ethenyl]benzoyl]but-2-enoate |
|---|---|
| PubChem CID | 162586255 |
| Molecular Formula | C38H45F3N6O5S |
| Molecular Weight | 754.88 g/mol |
| Exact Mass | 754.31 |
| IUPAC Name | ethyl (E)-2-[5-[6-(ethylcarbamoylamino)-4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-3-pyridinyl]-2-[1-[1-(2-morpholin-4-ylethyl)piperidin-3-yl]ethenyl]benzoyl]but-2-enoate |
| SMILES | C=C(c1ccc(-c2cnc(NC(=O)NCC)cc2-c2nc(C(F)(F)F)cs2)cc1C(=O)/C(=C\C)C(=O)OCC)C1CCCN(CCN2CCOCC2)C1 |
| InChI | InChI=1S/C38H45F3N6O5S/c1-5-27(36(49)52-7-3)34(48)29-19-25(10-11-28(29)24(4)26-9-8-12-47(22-26)14-13-46-15-17-51-18-16-46)31-21-43-33(45-37(50)42-6-2)20-30(31)35-44-32(23-53-35)38(39,40)41/h5,10-11,19-21,23,26H,4,6-9,12-18,22H2,1-3H3,(H2,42,43,45,50)/b27-5+ |
| InChIKey | RGJLEJTVSZTXTD-FZXKJZBHSA-N |
| XLogP | 6.78 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.88 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|