C25H23F4N3OS — CID 162586281
4-[[3,3-dimethyl-6-[4-(trifluoromethyl)phenyl]-2,4-dihydroquinolin-1-yl]sulfanyl]-2-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 162586281) has the molecular formula C25H23F4N3OS and a molecular weight of 489.54 g/mol. Its IUPAC name is 4-[[3,3-dimethyl-6-[4-(trifluoromethyl)phenyl]-2,4-dihydroquinolin-1-yl]sulfanyl]-2-fluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[[3,3-dimethyl-6-[4-(trifluoromethyl)phenyl]-2,4-dihydroquinolin-1-yl]sulfanyl]-2-fluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 162586281 |
| Molecular Formula | C25H23F4N3OS |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 4-[[3,3-dimethyl-6-[4-(trifluoromethyl)phenyl]-2,4-dihydroquinolin-1-yl]sulfanyl]-2-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | CC1(C)Cc2cc(-c3ccc(C(F)(F)F)cc3)ccc2N(Sc2ccc(C(N)=NO)c(F)c2)C1 |
| InChI | InChI=1S/C25H23F4N3OS/c1-24(2)13-17-11-16(15-3-6-18(7-4-15)25(27,28)29)5-10-22(17)32(14-24)34-19-8-9-20(21(26)12-19)23(30)31-33/h3-12,33H,13-14H2,1-2H3,(H2,30,31) |
| InChIKey | SMJIJXCVKMQKET-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|