C11H11F3N2O — CID 162586380
4-(2,2,2-trifluoro-1-prop-2-enoxyethyl)-1,2-dihydropyridine-2-carbonitrile (PubChem CID 162586380) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is 4-(2,2,2-trifluoro-1-prop-2-enoxyethyl)-1,2-dihydropyridine-2-carbonitrile.
| Compound Name | 4-(2,2,2-trifluoro-1-prop-2-enoxyethyl)-1,2-dihydropyridine-2-carbonitrile |
|---|---|
| PubChem CID | 162586380 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 4-(2,2,2-trifluoro-1-prop-2-enoxyethyl)-1,2-dihydropyridine-2-carbonitrile |
| SMILES | C=CCOC(C1=CC(C#N)NC=C1)C(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O/c1-2-5-17-10(11(12,13)14)8-3-4-16-9(6-8)7-15/h2-4,6,9-10,16H,1,5H2 |
| InChIKey | JRAZQOZBCUOKCP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|