C20H23F3N4O — CID 162586640
N-[2-tert-butyl-1-(4,4,4-trifluorobutyl)benzimidazol-5-yl]-N-pyridin-4-ylhydroxylamine (PubChem CID 162586640) has the molecular formula C20H23F3N4O and a molecular weight of 392.43 g/mol. Its IUPAC name is N-[2-tert-butyl-1-(4,4,4-trifluorobutyl)benzimidazol-5-yl]-N-pyridin-4-ylhydroxylamine.
| Compound Name | N-[2-tert-butyl-1-(4,4,4-trifluorobutyl)benzimidazol-5-yl]-N-pyridin-4-ylhydroxylamine |
|---|---|
| PubChem CID | 162586640 |
| Molecular Formula | C20H23F3N4O |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-[2-tert-butyl-1-(4,4,4-trifluorobutyl)benzimidazol-5-yl]-N-pyridin-4-ylhydroxylamine |
| SMILES | CC(C)(C)c1nc2cc(N(O)c3ccncc3)ccc2n1CCCC(F)(F)F |
| InChI | InChI=1S/C20H23F3N4O/c1-19(2,3)18-25-16-13-15(27(28)14-7-10-24-11-8-14)5-6-17(16)26(18)12-4-9-20(21,22)23/h5-8,10-11,13,28H,4,9,12H2,1-3H3 |
| InChIKey | JJLWENDHXGDRSI-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|