C21H25F3N7O4S2+ — CID 162586721
CID 162586721 (PubChem CID 162586721) has the molecular formula C21H25F3N7O4S2+ and a molecular weight of 560.60 g/mol.
| Compound Name | CID 162586721 |
|---|---|
| PubChem CID | 162586721 |
| Molecular Formula | C21H25F3N7O4S2+ |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | — |
| SMILES | CN(c1ncccc1CNc1nc(Nc2ccc([S+](=O)(O)N(C)C)cc2)ncc1C(F)(F)F)S(C)(=O)=O |
| InChI | InChI=1S/C21H24F3N7O4S2/c1-30(2)37(34,35)16-9-7-15(8-10-16)28-20-27-13-17(21(22,23)24)18(29-20)26-12-14-6-5-11-25-19(14)31(3)36(4,32)33/h5-11,13H,12H2,1-4H3,(H2-,26,27,28,29,34,35)/p+1 |
| InChIKey | AIKQKYBHKWZEAK-UHFFFAOYSA-O |
| XLogP | 3.45 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|