C8H13F2N3 — CID 162586926
N-(2,2-difluoroethyl)-4,5-dimethyl-3,4-dihydro-1H-pyrimidin-2-imine (PubChem CID 162586926) has the molecular formula C8H13F2N3 and a molecular weight of 189.21 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-4,5-dimethyl-3,4-dihydro-1H-pyrimidin-2-imine.
| Compound Name | N-(2,2-difluoroethyl)-4,5-dimethyl-3,4-dihydro-1H-pyrimidin-2-imine |
|---|---|
| PubChem CID | 162586926 |
| Molecular Formula | C8H13F2N3 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | N-(2,2-difluoroethyl)-4,5-dimethyl-3,4-dihydro-1H-pyrimidin-2-imine |
| SMILES | CC1=CN/C(=N\CC(F)F)NC1C |
| InChI | InChI=1S/C8H13F2N3/c1-5-3-11-8(13-6(5)2)12-4-7(9)10/h3,6-7H,4H2,1-2H3,(H2,11,12,13) |
| InChIKey | HUFFCSCLEIDQCP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|