C22H22ClF6N5O4 — CID 162587058
(1R,2R,3R)-1-[[6-chloro-5-[2-[2-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethynyl]-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-3-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 162587058) has the molecular formula C22H22ClF6N5O4 and a molecular weight of 569.89 g/mol. Its IUPAC name is (1R,2R,3R)-1-[[6-chloro-5-[2-[2-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethynyl]-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-3-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2R,3R)-1-[[6-chloro-5-[2-[2-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethynyl]-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-3-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 162587058 |
| Molecular Formula | C22H22ClF6N5O4 |
| Molecular Weight | 569.89 g/mol |
| Exact Mass | 569.13 |
| IUPAC Name | (1R,2R,3R)-1-[[6-chloro-5-[2-[2-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethynyl]-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-3-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | Cc1nc(OCC(F)(F)F)ccc1C#Cc1c(Cl)nc(NCC(F)(F)F)nc1N[C@@]1(O)CC[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C22H22ClF6N5O4/c1-11-12(3-5-15(31-11)38-10-22(27,28)29)2-4-14-17(23)32-19(30-9-21(24,25)26)33-18(14)34-20(37)7-6-13(8-35)16(20)36/h3,5,13,16,35-37H,6-10H2,1H3,(H2,30,32,33,34)/t13-,16-,20-/m1/s1 |
| InChIKey | AGMYHCZJQPHBND-OWDMVUQNSA-N |
| XLogP | 3.01 |
| TPSA | 132.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.89 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|