About 6-fluoro-N,1-dimethyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine
6-fluoro-N,1-dimethyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine (PubChem CID 162587705) has the molecular formula C9H11F4N
and a molecular weight of 209.19 g/mol. Its IUPAC name is 6-fluoro-N,1-dimethyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 6-fluoro-N,1-dimethyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine |
| PubChem CID | 162587705 |
| Molecular Formula | C9H11F4N |
| Molecular Weight | 209.19 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 6-fluoro-N,1-dimethyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine |
| SMILES | CNC1(C)C=CC(C(F)(F)F)=CC1F |
| InChI | InChI=1S/C9H11F4N/c1-8(14-2)4-3-6(5-7(8)10)9(11,12)13/h3-5,7,14H,1-2H3 |
| InChIKey | BNNMMDDSUWIMEP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-fluoro-N,1-dimethyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-N,1-dimethyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
The IUPAC name of 6-fluoro-N,1-dimethyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine (CID 162587705) is 6-fluoro-N,1-dimethyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 6-fluoro-N,1-dimethyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
The canonical SMILES for 6-fluoro-N,1-dimethyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine is CNC1(C)C=CC(C(F)(F)F)=CC1F.
What is the InChIKey of 6-fluoro-N,1-dimethyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
The InChIKey is BNNMMDDSUWIMEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F4N/c1-8(14-2)4-3-6(5-7(8)10)9(11,12)13/h3-5,7,14H,1-2H3.
What are the key properties of 6-fluoro-N,1-dimethyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
6-fluoro-N,1-dimethyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine has a molecular weight of 209.19 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-N,1-dimethyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 162587705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).