About 2-(1,1-difluoro-1-iodo-2-methylpropan-2-yl)-5-(methoxymethoxy)pyridine
2-(1,1-difluoro-1-iodo-2-methylpropan-2-yl)-5-(methoxymethoxy)pyridine (PubChem CID 162588321) has the molecular formula C11H14F2INO2
and a molecular weight of 357.14 g/mol. Its IUPAC name is 2-(1,1-difluoro-1-iodo-2-methylpropan-2-yl)-5-(methoxymethoxy)pyridine.
Molecular Properties
| Compound Name | 2-(1,1-difluoro-1-iodo-2-methylpropan-2-yl)-5-(methoxymethoxy)pyridine |
| PubChem CID | 162588321 |
| Molecular Formula | C11H14F2INO2 |
| Molecular Weight | 357.14 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 2-(1,1-difluoro-1-iodo-2-methylpropan-2-yl)-5-(methoxymethoxy)pyridine |
| SMILES | COCOc1ccc(C(C)(C)C(F)(F)I)nc1 |
| InChI | InChI=1S/C11H14F2INO2/c1-10(2,11(12,13)14)9-5-4-8(6-15-9)17-7-16-3/h4-6H,7H2,1-3H3 |
| InChIKey | UJLCUHKHTNVQNF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.14 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,1-difluoro-1-iodo-2-methylpropan-2-yl)-5-(methoxymethoxy)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-difluoro-1-iodo-2-methylpropan-2-yl)-5-(methoxymethoxy)pyridine?
The IUPAC name of 2-(1,1-difluoro-1-iodo-2-methylpropan-2-yl)-5-(methoxymethoxy)pyridine (CID 162588321) is 2-(1,1-difluoro-1-iodo-2-methylpropan-2-yl)-5-(methoxymethoxy)pyridine.
What is the SMILES notation for 2-(1,1-difluoro-1-iodo-2-methylpropan-2-yl)-5-(methoxymethoxy)pyridine?
The canonical SMILES for 2-(1,1-difluoro-1-iodo-2-methylpropan-2-yl)-5-(methoxymethoxy)pyridine is COCOc1ccc(C(C)(C)C(F)(F)I)nc1.
What is the InChIKey of 2-(1,1-difluoro-1-iodo-2-methylpropan-2-yl)-5-(methoxymethoxy)pyridine?
The InChIKey is UJLCUHKHTNVQNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2INO2/c1-10(2,11(12,13)14)9-5-4-8(6-15-9)17-7-16-3/h4-6H,7H2,1-3H3.
What are the key properties of 2-(1,1-difluoro-1-iodo-2-methylpropan-2-yl)-5-(methoxymethoxy)pyridine?
2-(1,1-difluoro-1-iodo-2-methylpropan-2-yl)-5-(methoxymethoxy)pyridine has a molecular weight of 357.14 g/mol, XLogP of 3.37, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-difluoro-1-iodo-2-methylpropan-2-yl)-5-(methoxymethoxy)pyridine is sourced from PubChem (CID 162588321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).