C26H32F3N7O4S2 — CID 162588646
3-(dihydroxyamino)-4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-N-[2-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl]benzenesulfonamide (PubChem CID 162588646) has the molecular formula C26H32F3N7O4S2 and a molecular weight of 627.72 g/mol. Its IUPAC name is 3-(dihydroxyamino)-4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-N-[2-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl]benzenesulfonamide.
| Compound Name | 3-(dihydroxyamino)-4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-N-[2-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 162588646 |
| Molecular Formula | C26H32F3N7O4S2 |
| Molecular Weight | 627.72 g/mol |
| Exact Mass | 627.19 |
| IUPAC Name | 3-(dihydroxyamino)-4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-N-[2-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl]benzenesulfonamide |
| SMILES | CN(C)CC[C@H](CSc1ccccc1)Nc1ccc(S(=O)(=O)Nc2nc(C(F)(F)F)nc3c2CCNC3)cc1N(O)O |
| InChI | InChI=1S/C26H32F3N7O4S2/c1-35(2)13-11-17(16-41-18-6-4-3-5-7-18)31-21-9-8-19(14-23(21)36(37)38)42(39,40)34-24-20-10-12-30-15-22(20)32-25(33-24)26(27,28)29/h3-9,14,17,30-31,37-38H,10-13,15-16H2,1-2H3,(H,32,33,34)/t17-/m1/s1 |
| InChIKey | SSVYPLCJHRIULP-QGZVFWFLSA-N |
| XLogP | 4.05 |
| TPSA | 142.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.72 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|